C14H19NO2 — CID 82172383
1-ethyl-5-(1-hydroxyethyl)-3,3-dimethylindol-2-one (PubChem CID 82172383) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 1-ethyl-5-(1-hydroxyethyl)-3,3-dimethylindol-2-one.
| Compound Name | 1-ethyl-5-(1-hydroxyethyl)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 82172383 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 1-ethyl-5-(1-hydroxyethyl)-3,3-dimethylindol-2-one |
| SMILES | CCN1C(=O)C(C)(C)c2cc(C(C)O)ccc21 |
| InChI | InChI=1S/C14H19NO2/c1-5-15-12-7-6-10(9(2)16)8-11(12)14(3,4)13(15)17/h6-9,16H,5H2,1-4H3 |
| InChIKey | LBFYIJJGSQPUPV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |