C14H21N3O3S — CID 125499834
1-ethyl-5-(ethylsulfamoylamino)-3,3-dimethylindol-2-one (PubChem CID 125499834) has the molecular formula C14H21N3O3S and a molecular weight of 311.41 g/mol. Its IUPAC name is 1-ethyl-5-(ethylsulfamoylamino)-3,3-dimethylindol-2-one.
| Compound Name | 1-ethyl-5-(ethylsulfamoylamino)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 125499834 |
| Molecular Formula | C14H21N3O3S |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | 1-ethyl-5-(ethylsulfamoylamino)-3,3-dimethylindol-2-one |
| SMILES | CCNS(=O)(=O)Nc1ccc2c(c1)C(C)(C)C(=O)N2CC |
| InChI | InChI=1S/C14H21N3O3S/c1-5-15-21(19,20)16-10-7-8-12-11(9-10)14(3,4)13(18)17(12)6-2/h7-9,15-16H,5-6H2,1-4H3 |
| InChIKey | PANJJSBFSRQIBF-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |