C17H18N2O — CID 82172771
5-[amino(phenyl)methyl]-3,7-dimethyl-1,3-dihydroindol-2-one (PubChem CID 82172771) has the molecular formula C17H18N2O and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-[amino(phenyl)methyl]-3,7-dimethyl-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino(phenyl)methyl]-3,7-dimethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82172771 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 5-[amino(phenyl)methyl]-3,7-dimethyl-1,3-dihydroindol-2-one |
| SMILES | Cc1cc(C(N)c2ccccc2)cc2c1NC(=O)C2C |
| InChI | InChI=1S/C17H18N2O/c1-10-8-13(15(18)12-6-4-3-5-7-12)9-14-11(2)17(20)19-16(10)14/h3-9,11,15H,18H2,1-2H3,(H,19,20) |
| InChIKey | FSHCWIWBMLQEDG-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |