C17H17FN2O — CID 82173281
7-[amino(phenyl)methyl]-3-ethyl-5-fluoro-1,3-dihydroindol-2-one (PubChem CID 82173281) has the molecular formula C17H17FN2O and a molecular weight of 284.33 g/mol. Its IUPAC name is 7-[amino(phenyl)methyl]-3-ethyl-5-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 7-[amino(phenyl)methyl]-3-ethyl-5-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82173281 |
| Molecular Formula | C17H17FN2O |
| Molecular Weight | 284.33 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 7-[amino(phenyl)methyl]-3-ethyl-5-fluoro-1,3-dihydroindol-2-one |
| SMILES | CCC1C(=O)Nc2c1cc(F)cc2C(N)c1ccccc1 |
| InChI | InChI=1S/C17H17FN2O/c1-2-12-13-8-11(18)9-14(16(13)20-17(12)21)15(19)10-6-4-3-5-7-10/h3-9,12,15H,2,19H2,1H3,(H,20,21) |
| InChIKey | GXUWPDBGUIMJDB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |