C20H24N2O — CID 82172665
7-[amino-(3-methylphenyl)methyl]-3,5-diethyl-1,3-dihydroindol-2-one (PubChem CID 82172665) has the molecular formula C20H24N2O and a molecular weight of 308.43 g/mol. Its IUPAC name is 7-[amino-(3-methylphenyl)methyl]-3,5-diethyl-1,3-dihydroindol-2-one.
| Compound Name | 7-[amino-(3-methylphenyl)methyl]-3,5-diethyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82172665 |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.43 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 7-[amino-(3-methylphenyl)methyl]-3,5-diethyl-1,3-dihydroindol-2-one |
| SMILES | CCc1cc2c(c(C(N)c3cccc(C)c3)c1)NC(=O)C2CC |
| InChI | InChI=1S/C20H24N2O/c1-4-13-10-16-15(5-2)20(23)22-19(16)17(11-13)18(21)14-8-6-7-12(3)9-14/h6-11,15,18H,4-5,21H2,1-3H3,(H,22,23) |
| InChIKey | ZNIHAWJYGBOEIV-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |