C14H18ClNO2 — CID 82173457
5-chloro-7-(1-hydroxybutyl)-3,3-dimethyl-1H-indol-2-one (PubChem CID 82173457) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 5-chloro-7-(1-hydroxybutyl)-3,3-dimethyl-1H-indol-2-one.
| Compound Name | 5-chloro-7-(1-hydroxybutyl)-3,3-dimethyl-1H-indol-2-one |
|---|---|
| PubChem CID | 82173457 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-chloro-7-(1-hydroxybutyl)-3,3-dimethyl-1H-indol-2-one |
| SMILES | CCCC(O)c1cc(Cl)cc2c1NC(=O)C2(C)C |
| InChI | InChI=1S/C14H18ClNO2/c1-4-5-11(17)9-6-8(15)7-10-12(9)16-13(18)14(10,2)3/h6-7,11,17H,4-5H2,1-3H3,(H,16,18) |
| InChIKey | FSUXINANMLMQOZ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |