C15H19FN2O — CID 82173516
5-[amino(cyclohexyl)methyl]-7-fluoro-1,3-dihydroindol-2-one (PubChem CID 82173516) has the molecular formula C15H19FN2O and a molecular weight of 262.33 g/mol. Its IUPAC name is 5-[amino(cyclohexyl)methyl]-7-fluoro-1,3-dihydroindol-2-one.
| Compound Name | 5-[amino(cyclohexyl)methyl]-7-fluoro-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82173516 |
| Molecular Formula | C15H19FN2O |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | 5-[amino(cyclohexyl)methyl]-7-fluoro-1,3-dihydroindol-2-one |
| SMILES | NC(c1cc(F)c2c(c1)CC(=O)N2)C1CCCCC1 |
| InChI | InChI=1S/C15H19FN2O/c16-12-7-10(6-11-8-13(19)18-15(11)12)14(17)9-4-2-1-3-5-9/h6-7,9,14H,1-5,8,17H2,(H,18,19) |
| InChIKey | ZXLBEICHECMDKA-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |