C11H12FNO2 — CID 82173521
7-fluoro-5-(1-hydroxypropyl)-1,3-dihydroindol-2-one (PubChem CID 82173521) has the molecular formula C11H12FNO2 and a molecular weight of 209.22 g/mol. Its IUPAC name is 7-fluoro-5-(1-hydroxypropyl)-1,3-dihydroindol-2-one.
| Compound Name | 7-fluoro-5-(1-hydroxypropyl)-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82173521 |
| Molecular Formula | C11H12FNO2 |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.09 |
| IUPAC Name | 7-fluoro-5-(1-hydroxypropyl)-1,3-dihydroindol-2-one |
| SMILES | CCC(O)c1cc(F)c2c(c1)CC(=O)N2 |
| InChI | InChI=1S/C11H12FNO2/c1-2-9(14)6-3-7-5-10(15)13-11(7)8(12)4-6/h3-4,9,14H,2,5H2,1H3,(H,13,15) |
| InChIKey | NJQXVGYAMHOLQH-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |