C14H18FNO2 — CID 82173571
7-fluoro-5-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one (PubChem CID 82173571) has the molecular formula C14H18FNO2 and a molecular weight of 251.30 g/mol. Its IUPAC name is 7-fluoro-5-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one.
| Compound Name | 7-fluoro-5-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one |
|---|---|
| PubChem CID | 82173571 |
| Molecular Formula | C14H18FNO2 |
| Molecular Weight | 251.30 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 7-fluoro-5-(1-hydroxypentyl)-3-methyl-1,3-dihydroindol-2-one |
| SMILES | CCCCC(O)c1cc(F)c2c(c1)C(C)C(=O)N2 |
| InChI | InChI=1S/C14H18FNO2/c1-3-4-5-12(17)9-6-10-8(2)14(18)16-13(10)11(15)7-9/h6-8,12,17H,3-5H2,1-2H3,(H,16,18) |
| InChIKey | XTGIMODKOSYXMU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |