C13H12FNO4 — CID 82667149
methyl 3-(7-fluoro-3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-oxopropanoate (PubChem CID 82667149) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is methyl 3-(7-fluoro-3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-oxopropanoate.
| Compound Name | methyl 3-(7-fluoro-3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-oxopropanoate |
|---|---|
| PubChem CID | 82667149 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl 3-(7-fluoro-3-methyl-2-oxo-1,3-dihydroindol-5-yl)-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)c1cc(F)c2c(c1)C(C)C(=O)N2 |
| InChI | InChI=1S/C13H12FNO4/c1-6-8-3-7(10(16)5-11(17)19-2)4-9(14)12(8)15-13(6)18/h3-4,6H,5H2,1-2H3,(H,15,18) |
| InChIKey | KUSNOQJBCHZTDJ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|