C11H12N4OS — CID 82176796
N-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]propanamide (PubChem CID 82176796) has the molecular formula C11H12N4OS and a molecular weight of 248.31 g/mol. Its IUPAC name is N-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]propanamide.
| Compound Name | N-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 82176796 |
| Molecular Formula | C11H12N4OS |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | N-[5-(2-aminophenyl)-1,3,4-thiadiazol-2-yl]propanamide |
| SMILES | CCC(=O)Nc1nnc(-c2ccccc2N)s1 |
| InChI | InChI=1S/C11H12N4OS/c1-2-9(16)13-11-15-14-10(17-11)7-5-3-4-6-8(7)12/h3-6H,2,12H2,1H3,(H,13,15,16) |
| InChIKey | BLZNIDCQNXGYIS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|