C13H17ClN4OS — CID 120607869
3-(2-aminophenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide;hydrochloride (PubChem CID 120607869) has the molecular formula C13H17ClN4OS and a molecular weight of 312.83 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide;hydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 120607869 |
| Molecular Formula | C13H17ClN4OS |
| Molecular Weight | 312.83 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | 3-(2-aminophenyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide;hydrochloride |
| SMILES | CCc1nnc(NC(=O)CCc2ccccc2N)s1.Cl |
| InChI | InChI=1S/C13H16N4OS.ClH/c1-2-12-16-17-13(19-12)15-11(18)8-7-9-5-3-4-6-10(9)14;/h3-6H,2,7-8,14H2,1H3,(H,15,17,18);1H |
| InChIKey | HBNUHBPQCXCYLH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.83 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|