C14H16N4O2S — CID 82176865
N-[5-(3-amino-4-methylphenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide (PubChem CID 82176865) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-[5-(3-amino-4-methylphenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | N-[5-(3-amino-4-methylphenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 82176865 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-[5-(3-amino-4-methylphenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide |
| SMILES | Cc1ccc(-c2nnc(NC(=O)C3CCCO3)s2)cc1N |
| InChI | InChI=1S/C14H16N4O2S/c1-8-4-5-9(7-10(8)15)13-17-18-14(21-13)16-12(19)11-3-2-6-20-11/h4-5,7,11H,2-3,6,15H2,1H3,(H,16,18,19) |
| InChIKey | GTVXYKYNGIZTSU-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|