C13H13FN4O2S — CID 82176877
N-[5-(3-amino-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide (PubChem CID 82176877) has the molecular formula C13H13FN4O2S and a molecular weight of 308.34 g/mol. Its IUPAC name is N-[5-(3-amino-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide.
| Compound Name | N-[5-(3-amino-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 82176877 |
| Molecular Formula | C13H13FN4O2S |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.07 |
| IUPAC Name | N-[5-(3-amino-4-fluorophenyl)-1,3,4-thiadiazol-2-yl]oxolane-2-carboxamide |
| SMILES | Nc1cc(-c2nnc(NC(=O)C3CCCO3)s2)ccc1F |
| InChI | InChI=1S/C13H13FN4O2S/c14-8-4-3-7(6-9(8)15)12-17-18-13(21-12)16-11(19)10-2-1-5-20-10/h3-4,6,10H,1-2,5,15H2,(H,16,18,19) |
| InChIKey | SOTOMJUPWWPTBX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|