C13H24N2 — CID 82183609
N,N-bis(prop-2-enyl)-3-pyrrolidin-2-ylpropan-1-amine (PubChem CID 82183609) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)-3-pyrrolidin-2-ylpropan-1-amine.
| Compound Name | N,N-bis(prop-2-enyl)-3-pyrrolidin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 82183609 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | N,N-bis(prop-2-enyl)-3-pyrrolidin-2-ylpropan-1-amine |
| SMILES | C=CCN(CC=C)CCCC1CCCN1 |
| InChI | InChI=1S/C13H24N2/c1-3-10-15(11-4-2)12-6-8-13-7-5-9-14-13/h3-4,13-14H,1-2,5-12H2 |
| InChIKey | LNPJPHIQLWLCRB-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|