C17H18N2O2S — CID 82184016
1-benzyl-3-butylthieno[2,3-c]pyrazole-5-carboxylic acid (PubChem CID 82184016) has the molecular formula C17H18N2O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 1-benzyl-3-butylthieno[2,3-c]pyrazole-5-carboxylic acid.
| Compound Name | 1-benzyl-3-butylthieno[2,3-c]pyrazole-5-carboxylic acid |
|---|---|
| PubChem CID | 82184016 |
| Molecular Formula | C17H18N2O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-benzyl-3-butylthieno[2,3-c]pyrazole-5-carboxylic acid |
| SMILES | CCCCc1nn(Cc2ccccc2)c2sc(C(=O)O)cc12 |
| InChI | InChI=1S/C17H18N2O2S/c1-2-3-9-14-13-10-15(17(20)21)22-16(13)19(18-14)11-12-7-5-4-6-8-12/h4-8,10H,2-3,9,11H2,1H3,(H,20,21) |
| InChIKey | AQWTYPIPVVYRDX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |