C19H24O4 — CID 82185820
4-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]butane-1,2-diol (PubChem CID 82185820) has the molecular formula C19H24O4 and a molecular weight of 316.40 g/mol. Its IUPAC name is 4-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]butane-1,2-diol.
| Compound Name | 4-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]butane-1,2-diol |
|---|---|
| PubChem CID | 82185820 |
| Molecular Formula | C19H24O4 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 4-[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]butane-1,2-diol |
| SMILES | COc1cccc(CCC(O)CO)c1OCc1cccc(C)c1 |
| InChI | InChI=1S/C19H24O4/c1-14-5-3-6-15(11-14)13-23-19-16(9-10-17(21)12-20)7-4-8-18(19)22-2/h3-8,11,17,20-21H,9-10,12-13H2,1-2H3 |
| InChIKey | GDQCGYZNBJFHQL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |