C23H31NO3 — CID 110534393
1-ethyl-3-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]piperidin-4-ol (PubChem CID 110534393) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is 1-ethyl-3-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]piperidin-4-ol.
| Compound Name | 1-ethyl-3-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 110534393 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | 1-ethyl-3-[[3-methoxy-2-[(3-methylphenyl)methoxy]phenyl]methyl]piperidin-4-ol |
| SMILES | CCN1CCC(O)C(Cc2cccc(OC)c2OCc2cccc(C)c2)C1 |
| InChI | InChI=1S/C23H31NO3/c1-4-24-12-11-21(25)20(15-24)14-19-9-6-10-22(26-3)23(19)27-16-18-8-5-7-17(2)13-18/h5-10,13,20-21,25H,4,11-12,14-16H2,1-3H3 |
| InChIKey | IIFHIELNSQMIIU-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |