C18H29NO4 — CID 110537452
3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol (PubChem CID 110537452) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol.
| Compound Name | 3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 110537452 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 3-[(4-ethoxy-3,5-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol |
| SMILES | CCOc1c(OC)cc(CC2CN(CC)CCC2O)cc1OC |
| InChI | InChI=1S/C18H29NO4/c1-5-19-8-7-15(20)14(12-19)9-13-10-16(21-3)18(23-6-2)17(11-13)22-4/h10-11,14-15,20H,5-9,12H2,1-4H3 |
| InChIKey | ASBUMGBRACTVHT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |