C16H23Cl2NO3 — CID 110535975
3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol (PubChem CID 110535975) has the molecular formula C16H23Cl2NO3 and a molecular weight of 348.27 g/mol. Its IUPAC name is 3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol.
| Compound Name | 3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 110535975 |
| Molecular Formula | C16H23Cl2NO3 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.11 |
| IUPAC Name | 3-[(3,5-dichloro-2,4-dimethoxyphenyl)methyl]-1-ethylpiperidin-4-ol |
| SMILES | CCN1CCC(O)C(Cc2cc(Cl)c(OC)c(Cl)c2OC)C1 |
| InChI | InChI=1S/C16H23Cl2NO3/c1-4-19-6-5-13(20)11(9-19)7-10-8-12(17)16(22-3)14(18)15(10)21-2/h8,11,13,20H,4-7,9H2,1-3H3 |
| InChIKey | XTSDOFPGFNVDSA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |