C18H30N2O3 — CID 110535672
3-[(3-amino-5-methoxy-4-propan-2-yloxyphenyl)methyl]-1-ethylpiperidin-4-ol (PubChem CID 110535672) has the molecular formula C18H30N2O3 and a molecular weight of 322.45 g/mol. Its IUPAC name is 3-[(3-amino-5-methoxy-4-propan-2-yloxyphenyl)methyl]-1-ethylpiperidin-4-ol.
| Compound Name | 3-[(3-amino-5-methoxy-4-propan-2-yloxyphenyl)methyl]-1-ethylpiperidin-4-ol |
|---|---|
| PubChem CID | 110535672 |
| Molecular Formula | C18H30N2O3 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.23 |
| IUPAC Name | 3-[(3-amino-5-methoxy-4-propan-2-yloxyphenyl)methyl]-1-ethylpiperidin-4-ol |
| SMILES | CCN1CCC(O)C(Cc2cc(N)c(OC(C)C)c(OC)c2)C1 |
| InChI | InChI=1S/C18H30N2O3/c1-5-20-7-6-16(21)14(11-20)8-13-9-15(19)18(23-12(2)3)17(10-13)22-4/h9-10,12,14,16,21H,5-8,11,19H2,1-4H3 |
| InChIKey | YKKJBVDDHPWAME-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 67.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|