C20H21ClO2 — CID 82185916
2-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexan-1-one (PubChem CID 82185916) has the molecular formula C20H21ClO2 and a molecular weight of 328.84 g/mol. Its IUPAC name is 2-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexan-1-one.
| Compound Name | 2-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 82185916 |
| Molecular Formula | C20H21ClO2 |
| Molecular Weight | 328.84 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 2-[[4-[(2-chlorophenyl)methoxy]phenyl]methyl]cyclohexan-1-one |
| SMILES | O=C1CCCCC1Cc1ccc(OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClO2/c21-19-7-3-1-6-17(19)14-23-18-11-9-15(10-12-18)13-16-5-2-4-8-20(16)22/h1,3,6-7,9-12,16H,2,4-5,8,13-14H2 |
| InChIKey | NYFWESQSEPSBPA-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.84 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |