C18H21NO3 — CID 82187577
5-[[bis(prop-2-enyl)amino]methyl]-3,7-dimethyl-1-benzofuran-2-carboxylic acid (PubChem CID 82187577) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is 5-[[bis(prop-2-enyl)amino]methyl]-3,7-dimethyl-1-benzofuran-2-carboxylic acid.
| Compound Name | 5-[[bis(prop-2-enyl)amino]methyl]-3,7-dimethyl-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 82187577 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 5-[[bis(prop-2-enyl)amino]methyl]-3,7-dimethyl-1-benzofuran-2-carboxylic acid |
| SMILES | C=CCN(CC=C)Cc1cc(C)c2oc(C(=O)O)c(C)c2c1 |
| InChI | InChI=1S/C18H21NO3/c1-5-7-19(8-6-2)11-14-9-12(3)16-15(10-14)13(4)17(22-16)18(20)21/h5-6,9-10H,1-2,7-8,11H2,3-4H3,(H,20,21) |
| InChIKey | ULDPTXRPLSTSGV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|