C16H18FNO3 — CID 82187611
7-fluoro-3-methyl-5-(piperidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid (PubChem CID 82187611) has the molecular formula C16H18FNO3 and a molecular weight of 291.32 g/mol. Its IUPAC name is 7-fluoro-3-methyl-5-(piperidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 7-fluoro-3-methyl-5-(piperidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 82187611 |
| Molecular Formula | C16H18FNO3 |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 7-fluoro-3-methyl-5-(piperidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid |
| SMILES | Cc1c(C(=O)O)oc2c(F)cc(CN3CCCCC3)cc12 |
| InChI | InChI=1S/C16H18FNO3/c1-10-12-7-11(9-18-5-3-2-4-6-18)8-13(17)15(12)21-14(10)16(19)20/h7-8H,2-6,9H2,1H3,(H,19,20) |
| InChIKey | RZAOJIKUZGDKIK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |