C14H14FNO3 — CID 82187810
7-fluoro-3-(pyrrolidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid (PubChem CID 82187810) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 7-fluoro-3-(pyrrolidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 7-fluoro-3-(pyrrolidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 82187810 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 7-fluoro-3-(pyrrolidin-1-ylmethyl)-1-benzofuran-2-carboxylic acid |
| SMILES | O=C(O)c1oc2c(F)cccc2c1CN1CCCC1 |
| InChI | InChI=1S/C14H14FNO3/c15-11-5-3-4-9-10(8-16-6-1-2-7-16)13(14(17)18)19-12(9)11/h3-5H,1-2,6-8H2,(H,17,18) |
| InChIKey | VITWXNBFKIKYGC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |