C11H9FO4 — CID 114358978
7-fluoro-3-(methoxymethyl)-1-benzofuran-2-carboxylic acid (PubChem CID 114358978) has the molecular formula C11H9FO4 and a molecular weight of 224.19 g/mol. Its IUPAC name is 7-fluoro-3-(methoxymethyl)-1-benzofuran-2-carboxylic acid.
| Compound Name | 7-fluoro-3-(methoxymethyl)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 114358978 |
| Molecular Formula | C11H9FO4 |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 7-fluoro-3-(methoxymethyl)-1-benzofuran-2-carboxylic acid |
| SMILES | COCc1c(C(=O)O)oc2c(F)cccc12 |
| InChI | InChI=1S/C11H9FO4/c1-15-5-7-6-3-2-4-8(12)9(6)16-10(7)11(13)14/h2-4H,5H2,1H3,(H,13,14) |
| InChIKey | RTEUDMLWNXAYDK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |