C14H12ClN3OS — CID 82194220
(E)-1-(2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-3-(2-chlorophenyl)prop-2-en-1-one (PubChem CID 82194220) has the molecular formula C14H12ClN3OS and a molecular weight of 305.79 g/mol. Its IUPAC name is (E)-1-(2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-3-(2-chlorophenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-3-(2-chlorophenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 82194220 |
| Molecular Formula | C14H12ClN3OS |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.04 |
| IUPAC Name | (E)-1-(2-amino-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-5-yl)-3-(2-chlorophenyl)prop-2-en-1-one |
| SMILES | Nc1nc2c(s1)CN(C(=O)/C=C/c1ccccc1Cl)C2 |
| InChI | InChI=1S/C14H12ClN3OS/c15-10-4-2-1-3-9(10)5-6-13(19)18-7-11-12(8-18)20-14(16)17-11/h1-6H,7-8H2,(H2,16,17)/b6-5+ |
| InChIKey | IJVLIKKTAAUDIU-AATRIKPKSA-N |
| XLogP | 2.93 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|