C22H21ClN4O — CID 108763829
(E)-3-(2-chlorophenyl)-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 108763829) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 108763829 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-(3-methylquinoxalin-2-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc2ccccc2nc1N1CCN(C(=O)/C=C/c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H21ClN4O/c1-16-22(25-20-9-5-4-8-19(20)24-16)27-14-12-26(13-15-27)21(28)11-10-17-6-2-3-7-18(17)23/h2-11H,12-15H2,1H3/b11-10+ |
| InChIKey | CGUUWBPLYJMPBZ-ZHACJKMWSA-N |
| XLogP | 3.95 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|