C22H22ClN5O — CID 122342356
(E)-3-(2-chlorophenyl)-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 122342356) has the molecular formula C22H22ClN5O and a molecular weight of 407.91 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122342356 |
| Molecular Formula | C22H22ClN5O |
| Molecular Weight | 407.91 g/mol |
| Exact Mass | 407.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nc(N2CCN(C(=O)/C=C/c3ccccc3Cl)CC2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C22H22ClN5O/c1-17-24-20(26-10-4-5-11-26)16-21(25-17)27-12-14-28(15-13-27)22(29)9-8-18-6-2-3-7-19(18)23/h2-11,16H,12-15H2,1H3/b9-8+ |
| InChIKey | LPBKGBVTRQLMSD-CMDGGOBGSA-N |
| XLogP | 3.59 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.91 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|