C21H21ClN6O — CID 121113864
(E)-3-(2-chlorophenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 121113864) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121113864 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1nccn1-c1ccc(N2CCN(C(=O)/C=C/c3ccccc3Cl)CC2)nn1 |
| InChI | InChI=1S/C21H21ClN6O/c1-16-23-10-11-28(16)20-8-7-19(24-25-20)26-12-14-27(15-13-26)21(29)9-6-17-4-2-3-5-18(17)22/h2-11H,12-15H2,1H3/b9-6+ |
| InChIKey | NFTHVOQMAXXUNK-RMKNXTFCSA-N |
| XLogP | 2.99 |
| TPSA | 67.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|