C23H23ClN6O — CID 122351352
(E)-3-(2-chlorophenyl)-1-[4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122351352) has the molecular formula C23H23ClN6O and a molecular weight of 434.93 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122351352 |
| Molecular Formula | C23H23ClN6O |
| Molecular Weight | 434.93 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-[6-[(5-methyl-2-pyridinyl)amino]pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1ccc(Nc2ccc(N3CCN(C(=O)/C=C/c4ccccc4Cl)CC3)nn2)nc1 |
| InChI | InChI=1S/C23H23ClN6O/c1-17-6-8-20(25-16-17)26-21-9-10-22(28-27-21)29-12-14-30(15-13-29)23(31)11-7-18-4-2-3-5-19(18)24/h2-11,16H,12-15H2,1H3,(H,25,26,27)/b11-7+ |
| InChIKey | MJWKEGAOZYTDBP-YRNVUSSQSA-N |
| XLogP | 3.94 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.93 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|