C23H26N6O3 — CID 121113797
(E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 121113797) has the molecular formula C23H26N6O3 and a molecular weight of 434.50 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 121113797 |
| Molecular Formula | C23H26N6O3 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-(2-methylimidazol-1-yl)pyridazin-3-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(c3ccc(-n4ccnc4C)nn3)CC2)cc1OC |
| InChI | InChI=1S/C23H26N6O3/c1-17-24-10-11-29(17)22-8-7-21(25-26-22)27-12-14-28(15-13-27)23(30)9-5-18-4-6-19(31-2)20(16-18)32-3/h4-11,16H,12-15H2,1-3H3/b9-5+ |
| InChIKey | FWITVEJUURIQKN-WEVVVXLNSA-N |
| XLogP | 2.35 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|