C25H28N6O3 — CID 122349367
(E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one (PubChem CID 122349367) has the molecular formula C25H28N6O3 and a molecular weight of 460.54 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 122349367 |
| Molecular Formula | C25H28N6O3 |
| Molecular Weight | 460.54 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-1-[4-[6-[(4-methyl-2-pyridinyl)amino]pyrimidin-4-yl]piperazin-1-yl]prop-2-en-1-one |
| SMILES | COc1ccc(/C=C/C(=O)N2CCN(c3cc(Nc4cc(C)ccn4)ncn3)CC2)cc1OC |
| InChI | InChI=1S/C25H28N6O3/c1-18-8-9-26-22(14-18)29-23-16-24(28-17-27-23)30-10-12-31(13-11-30)25(32)7-5-19-4-6-20(33-2)21(15-19)34-3/h4-9,14-17H,10-13H2,1-3H3,(H,26,27,28,29)/b7-5+ |
| InChIKey | NVKOUYBZUDRNSC-FNORWQNLSA-N |
| XLogP | 3.30 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.54 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|