C24H29N5O — CID 122342214
(4-tert-butylphenyl)-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122342214) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is (4-tert-butylphenyl)-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | (4-tert-butylphenyl)-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122342214 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | (4-tert-butylphenyl)-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(N2CCN(C(=O)c3ccc(C(C)(C)C)cc3)CC2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C24H29N5O/c1-18-25-21(27-11-5-6-12-27)17-22(26-18)28-13-15-29(16-14-28)23(30)19-7-9-20(10-8-19)24(2,3)4/h5-12,17H,13-16H2,1-4H3 |
| InChIKey | ABMBTYKHLNUTKK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |