C22H22N6O — CID 122342479
indolizin-2-yl-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 122342479) has the molecular formula C22H22N6O and a molecular weight of 386.46 g/mol. Its IUPAC name is indolizin-2-yl-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | indolizin-2-yl-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 122342479 |
| Molecular Formula | C22H22N6O |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | indolizin-2-yl-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | Cc1nc(N2CCN(C(=O)c3cc4ccccn4c3)CC2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C22H22N6O/c1-17-23-20(25-7-4-5-8-25)15-21(24-17)26-10-12-27(13-11-26)22(29)18-14-19-6-2-3-9-28(19)16-18/h2-9,14-16H,10-13H2,1H3 |
| InChIKey | HTEZZNLNLBSECO-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |