C26H25N5O2 — CID 122342360
[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]-(2-phenoxyphenyl)methanone (PubChem CID 122342360) has the molecular formula C26H25N5O2 and a molecular weight of 439.52 g/mol. Its IUPAC name is [4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]-(2-phenoxyphenyl)methanone.
| Compound Name | [4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]-(2-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 122342360 |
| Molecular Formula | C26H25N5O2 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | [4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]-(2-phenoxyphenyl)methanone |
| SMILES | Cc1nc(N2CCN(C(=O)c3ccccc3Oc3ccccc3)CC2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C26H25N5O2/c1-20-27-24(29-13-7-8-14-29)19-25(28-20)30-15-17-31(18-16-30)26(32)22-11-5-6-12-23(22)33-21-9-3-2-4-10-21/h2-14,19H,15-18H2,1H3 |
| InChIKey | FVKKXYVKOWWTLI-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |