C17H23N5O — CID 122342201
2-methyl-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one (PubChem CID 122342201) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is 2-methyl-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one.
| Compound Name | 2-methyl-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 122342201 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 2-methyl-1-[4-(2-methyl-6-pyrrol-1-ylpyrimidin-4-yl)piperazin-1-yl]propan-1-one |
| SMILES | Cc1nc(N2CCN(C(=O)C(C)C)CC2)cc(-n2cccc2)n1 |
| InChI | InChI=1S/C17H23N5O/c1-13(2)17(23)22-10-8-21(9-11-22)16-12-15(18-14(3)19-16)20-6-4-5-7-20/h4-7,12-13H,8-11H2,1-3H3 |
| InChIKey | JWVIRIDYSUQANH-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |