C21H24Cl2N4O — CID 26953725
(E)-3-(2,3-dichlorophenyl)-1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one (PubChem CID 26953725) has the molecular formula C21H24Cl2N4O and a molecular weight of 419.36 g/mol. Its IUPAC name is (E)-3-(2,3-dichlorophenyl)-1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,3-dichlorophenyl)-1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 26953725 |
| Molecular Formula | C21H24Cl2N4O |
| Molecular Weight | 419.36 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | (E)-3-(2,3-dichlorophenyl)-1-[4-(6-methyl-2-propan-2-ylpyrimidin-4-yl)piperazin-1-yl]prop-2-en-1-one |
| SMILES | Cc1cc(N2CCN(C(=O)/C=C/c3cccc(Cl)c3Cl)CC2)nc(C(C)C)n1 |
| InChI | InChI=1S/C21H24Cl2N4O/c1-14(2)21-24-15(3)13-18(25-21)26-9-11-27(12-10-26)19(28)8-7-16-5-4-6-17(22)20(16)23/h4-8,13-14H,9-12H2,1-3H3/b8-7+ |
| InChIKey | ANMOFVLPGRNCCW-BQYQJAHWSA-N |
| XLogP | 4.58 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.36 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|