C15H19N3O — CID 82195790
5-butyl-1-(2,5-dimethylphenyl)triazole-4-carbaldehyde (PubChem CID 82195790) has the molecular formula C15H19N3O and a molecular weight of 257.34 g/mol. Its IUPAC name is 5-butyl-1-(2,5-dimethylphenyl)triazole-4-carbaldehyde.
| Compound Name | 5-butyl-1-(2,5-dimethylphenyl)triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 82195790 |
| Molecular Formula | C15H19N3O |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.15 |
| IUPAC Name | 5-butyl-1-(2,5-dimethylphenyl)triazole-4-carbaldehyde |
| SMILES | CCCCc1c(C=O)nnn1-c1cc(C)ccc1C |
| InChI | InChI=1S/C15H19N3O/c1-4-5-6-14-13(10-19)16-17-18(14)15-9-11(2)7-8-12(15)3/h7-10H,4-6H2,1-3H3 |
| InChIKey | PVDDNKUAQVPZOC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|