C13H16N4O3S — CID 94938429
4-(5-butyl-4-formyltriazol-1-yl)benzenesulfonamide (PubChem CID 94938429) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 4-(5-butyl-4-formyltriazol-1-yl)benzenesulfonamide.
| Compound Name | 4-(5-butyl-4-formyltriazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 94938429 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-(5-butyl-4-formyltriazol-1-yl)benzenesulfonamide |
| SMILES | CCCCc1c(C=O)nnn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-2-3-4-13-12(9-18)15-16-17(13)10-5-7-11(8-6-10)21(14,19)20/h5-9H,2-4H2,1H3,(H2,14,19,20) |
| InChIKey | AMDUHWMDJYAYSV-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|