C15H21N5O — CID 82199693
4-[4-(aminomethyl)-5-(oxolan-2-yl)triazol-1-yl]-N,N-dimethylaniline (PubChem CID 82199693) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-5-(oxolan-2-yl)triazol-1-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(aminomethyl)-5-(oxolan-2-yl)triazol-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82199693 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | 4-[4-(aminomethyl)-5-(oxolan-2-yl)triazol-1-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-n2nnc(CN)c2C2CCCO2)cc1 |
| InChI | InChI=1S/C15H21N5O/c1-19(2)11-5-7-12(8-6-11)20-15(13(10-16)17-18-20)14-4-3-9-21-14/h5-8,14H,3-4,9-10,16H2,1-2H3 |
| InChIKey | UFCQMZLTZDGEGN-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|