C18H21N5 — CID 94939636
4-[4-(aminomethyl)-5-(2-methylphenyl)triazol-1-yl]-N,N-dimethylaniline (PubChem CID 94939636) has the molecular formula C18H21N5 and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-[4-(aminomethyl)-5-(2-methylphenyl)triazol-1-yl]-N,N-dimethylaniline.
| Compound Name | 4-[4-(aminomethyl)-5-(2-methylphenyl)triazol-1-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 94939636 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | 4-[4-(aminomethyl)-5-(2-methylphenyl)triazol-1-yl]-N,N-dimethylaniline |
| SMILES | Cc1ccccc1-c1c(CN)nnn1-c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C18H21N5/c1-13-6-4-5-7-16(13)18-17(12-19)20-21-23(18)15-10-8-14(9-11-15)22(2)3/h4-11H,12,19H2,1-3H3 |
| InChIKey | UBYIWBKYOPEOGY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|