C15H19N3O3 — CID 82200548
methyl 3-[5-butyl-4-(hydroxymethyl)triazol-1-yl]benzoate (PubChem CID 82200548) has the molecular formula C15H19N3O3 and a molecular weight of 289.34 g/mol. Its IUPAC name is methyl 3-[5-butyl-4-(hydroxymethyl)triazol-1-yl]benzoate.
| Compound Name | methyl 3-[5-butyl-4-(hydroxymethyl)triazol-1-yl]benzoate |
|---|---|
| PubChem CID | 82200548 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | methyl 3-[5-butyl-4-(hydroxymethyl)triazol-1-yl]benzoate |
| SMILES | CCCCc1c(CO)nnn1-c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C15H19N3O3/c1-3-4-8-14-13(10-19)16-17-18(14)12-7-5-6-11(9-12)15(20)21-2/h5-7,9,19H,3-4,8,10H2,1-2H3 |
| InChIKey | HUFBXNVKONVYRU-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |