C15H17N3O4 — CID 82200566
methyl 3-[4-(hydroxymethyl)-5-(oxolan-2-yl)triazol-1-yl]benzoate (PubChem CID 82200566) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is methyl 3-[4-(hydroxymethyl)-5-(oxolan-2-yl)triazol-1-yl]benzoate.
| Compound Name | methyl 3-[4-(hydroxymethyl)-5-(oxolan-2-yl)triazol-1-yl]benzoate |
|---|---|
| PubChem CID | 82200566 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | methyl 3-[4-(hydroxymethyl)-5-(oxolan-2-yl)triazol-1-yl]benzoate |
| SMILES | COC(=O)c1cccc(-n2nnc(CO)c2C2CCCO2)c1 |
| InChI | InChI=1S/C15H17N3O4/c1-21-15(20)10-4-2-5-11(8-10)18-14(12(9-19)16-17-18)13-6-3-7-22-13/h2,4-5,8,13,19H,3,6-7,9H2,1H3 |
| InChIKey | PZGLJSCMTFEBTJ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |