C11H6F3N3O4 — CID 82201364
1-(3-carboxyphenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid (PubChem CID 82201364) has the molecular formula C11H6F3N3O4 and a molecular weight of 301.18 g/mol. Its IUPAC name is 1-(3-carboxyphenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid.
| Compound Name | 1-(3-carboxyphenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 82201364 |
| Molecular Formula | C11H6F3N3O4 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 301.03 |
| IUPAC Name | 1-(3-carboxyphenyl)-5-(trifluoromethyl)triazole-4-carboxylic acid |
| SMILES | O=C(O)c1cccc(-n2nnc(C(=O)O)c2C(F)(F)F)c1 |
| InChI | InChI=1S/C11H6F3N3O4/c12-11(13,14)8-7(10(20)21)15-16-17(8)6-3-1-2-5(4-6)9(18)19/h1-4H,(H,18,19)(H,20,21) |
| InChIKey | XHWJZTSZWCBCDD-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |