C19H31N3 — CID 82201637
1-[2-(3,5-dimethylpiperidin-1-yl)-2-phenylethyl]piperazine (PubChem CID 82201637) has the molecular formula C19H31N3 and a molecular weight of 301.48 g/mol. Its IUPAC name is 1-[2-(3,5-dimethylpiperidin-1-yl)-2-phenylethyl]piperazine.
| Compound Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-phenylethyl]piperazine |
|---|---|
| PubChem CID | 82201637 |
| Molecular Formula | C19H31N3 |
| Molecular Weight | 301.48 g/mol |
| Exact Mass | 301.25 |
| IUPAC Name | 1-[2-(3,5-dimethylpiperidin-1-yl)-2-phenylethyl]piperazine |
| SMILES | CC1CC(C)CN(C(CN2CCNCC2)c2ccccc2)C1 |
| InChI | InChI=1S/C19H31N3/c1-16-12-17(2)14-22(13-16)19(18-6-4-3-5-7-18)15-21-10-8-20-9-11-21/h3-7,16-17,19-20H,8-15H2,1-2H3 |
| InChIKey | BSTBAIBQSXKFSP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.48 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |