C15H26N4 — CID 82201783
N,N-diethyl-2-piperazin-1-yl-1-pyridin-3-ylethanamine (PubChem CID 82201783) has the molecular formula C15H26N4 and a molecular weight of 262.40 g/mol. Its IUPAC name is N,N-diethyl-2-piperazin-1-yl-1-pyridin-3-ylethanamine.
| Compound Name | N,N-diethyl-2-piperazin-1-yl-1-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 82201783 |
| Molecular Formula | C15H26N4 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.22 |
| IUPAC Name | N,N-diethyl-2-piperazin-1-yl-1-pyridin-3-ylethanamine |
| SMILES | CCN(CC)C(CN1CCNCC1)c1cccnc1 |
| InChI | InChI=1S/C15H26N4/c1-3-19(4-2)15(14-6-5-7-17-12-14)13-18-10-8-16-9-11-18/h5-7,12,15-16H,3-4,8-11,13H2,1-2H3 |
| InChIKey | QNIUMJYRSYLLEU-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |