C18H30ClN3 — CID 82201682
N-[1-(4-chlorophenyl)-2-piperazin-1-ylethyl]-N-ethylbutan-1-amine (PubChem CID 82201682) has the molecular formula C18H30ClN3 and a molecular weight of 323.91 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-2-piperazin-1-ylethyl]-N-ethylbutan-1-amine.
| Compound Name | N-[1-(4-chlorophenyl)-2-piperazin-1-ylethyl]-N-ethylbutan-1-amine |
|---|---|
| PubChem CID | 82201682 |
| Molecular Formula | C18H30ClN3 |
| Molecular Weight | 323.91 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N-[1-(4-chlorophenyl)-2-piperazin-1-ylethyl]-N-ethylbutan-1-amine |
| SMILES | CCCCN(CC)C(CN1CCNCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H30ClN3/c1-3-5-12-22(4-2)18(15-21-13-10-20-11-14-21)16-6-8-17(19)9-7-16/h6-9,18,20H,3-5,10-15H2,1-2H3 |
| InChIKey | UWVVBHPTTOHUFP-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.91 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |