C20H32N4 — CID 82201882
4-[1-[bis(prop-2-enyl)amino]-2-piperazin-1-ylethyl]-N,N-dimethylaniline (PubChem CID 82201882) has the molecular formula C20H32N4 and a molecular weight of 328.50 g/mol. Its IUPAC name is 4-[1-[bis(prop-2-enyl)amino]-2-piperazin-1-ylethyl]-N,N-dimethylaniline.
| Compound Name | 4-[1-[bis(prop-2-enyl)amino]-2-piperazin-1-ylethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82201882 |
| Molecular Formula | C20H32N4 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.26 |
| IUPAC Name | 4-[1-[bis(prop-2-enyl)amino]-2-piperazin-1-ylethyl]-N,N-dimethylaniline |
| SMILES | C=CCN(CC=C)C(CN1CCNCC1)c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C20H32N4/c1-5-13-24(14-6-2)20(17-23-15-11-21-12-16-23)18-7-9-19(10-8-18)22(3)4/h5-10,20-21H,1-2,11-17H2,3-4H3 |
| InChIKey | JQRYHGRNNZONPH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|