C16H25ClN2 — CID 82215457
4-[2-(azepan-1-yl)-1-chloroethyl]-N,N-dimethylaniline (PubChem CID 82215457) has the molecular formula C16H25ClN2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-1-chloroethyl]-N,N-dimethylaniline.
| Compound Name | 4-[2-(azepan-1-yl)-1-chloroethyl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 82215457 |
| Molecular Formula | C16H25ClN2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 4-[2-(azepan-1-yl)-1-chloroethyl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(C(Cl)CN2CCCCCC2)cc1 |
| InChI | InChI=1S/C16H25ClN2/c1-18(2)15-9-7-14(8-10-15)16(17)13-19-11-5-3-4-6-12-19/h7-10,16H,3-6,11-13H2,1-2H3 |
| InChIKey | COPVSYRQAKSUFX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|